C41H38ClN3O2S — CID 21329656
3,3-dimethyl-7-oxo-N-[(4-phenylmethoxyphenyl)methyl]-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboximidoyl chloride (PubChem CID 21329656) has the molecular formula C41H38ClN3O2S and a molecular weight of 672.29 g/mol. Its IUPAC name is 3,3-dimethyl-7-oxo-N-[(4-phenylmethoxyphenyl)methyl]-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboximidoyl chloride.
| Compound Name | 3,3-dimethyl-7-oxo-N-[(4-phenylmethoxyphenyl)methyl]-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboximidoyl chloride |
|---|---|
| PubChem CID | 21329656 |
| Molecular Formula | C41H38ClN3O2S |
| Molecular Weight | 672.29 g/mol |
| Exact Mass | 671.24 |
| IUPAC Name | 3,3-dimethyl-7-oxo-N-[(4-phenylmethoxyphenyl)methyl]-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboximidoyl chloride |
| SMILES | CC1(C)SC2C(NC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)N2C1/C(Cl)=N/Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C41H38ClN3O2S/c1-40(2)36(37(42)43-27-29-23-25-34(26-24-29)47-28-30-15-7-3-8-16-30)45-38(46)35(39(45)48-40)44-41(31-17-9-4-10-18-31,32-19-11-5-12-20-32)33-21-13-6-14-22-33/h3-26,35-36,39,44H,27-28H2,1-2H3/b43-37- |
| InChIKey | WHLXAKQCUDDTFQ-KRVRMENKSA-N |
| XLogP | 8.42 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.29 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|