C35H34ClN3O2S — CID 86734829
(5R)-N-[(4-methoxyphenyl)methyl]-3,3-dimethyl-7-oxo-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboximidoyl chloride (PubChem CID 86734829) has the molecular formula C35H34ClN3O2S and a molecular weight of 596.20 g/mol. Its IUPAC name is (5R)-N-[(4-methoxyphenyl)methyl]-3,3-dimethyl-7-oxo-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboximidoyl chloride.
| Compound Name | (5R)-N-[(4-methoxyphenyl)methyl]-3,3-dimethyl-7-oxo-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboximidoyl chloride |
|---|---|
| PubChem CID | 86734829 |
| Molecular Formula | C35H34ClN3O2S |
| Molecular Weight | 596.20 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | (5R)-N-[(4-methoxyphenyl)methyl]-3,3-dimethyl-7-oxo-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboximidoyl chloride |
| SMILES | COc1ccc(C/N=C(\Cl)C2N3C(=O)C(NC(c4ccccc4)(c4ccccc4)c4ccccc4)[C@H]3SC2(C)C)cc1 |
| InChI | InChI=1S/C35H34ClN3O2S/c1-34(2)30(31(36)37-23-24-19-21-28(41-3)22-20-24)39-32(40)29(33(39)42-34)38-35(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-22,29-30,33,38H,23H2,1-3H3/b37-31-/t29?,30?,33-/m1/s1 |
| InChIKey | LOQXTYKNICRHAG-LFGRFWQZSA-N |
| XLogP | 6.85 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.20 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|