C53H46N6O2S — CID 70605688
(5R)-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-3,3-dimethyl-6-[tris(4-phenylphenyl)methylamino]-4-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 70605688) has the molecular formula C53H46N6O2S and a molecular weight of 831.06 g/mol. Its IUPAC name is (5R)-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-3,3-dimethyl-6-[tris(4-phenylphenyl)methylamino]-4-thia-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (5R)-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-3,3-dimethyl-6-[tris(4-phenylphenyl)methylamino]-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 70605688 |
| Molecular Formula | C53H46N6O2S |
| Molecular Weight | 831.06 g/mol |
| Exact Mass | 830.34 |
| IUPAC Name | (5R)-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-3,3-dimethyl-6-[tris(4-phenylphenyl)methylamino]-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | COc1ccc(Cn2nnnc2C2N3C(=O)C(NC(c4ccc(-c5ccccc5)cc4)(c4ccc(-c5ccccc5)cc4)c4ccc(-c5ccccc5)cc4)[C@H]3SC2(C)C)cc1 |
| InChI | InChI=1S/C53H46N6O2S/c1-52(2)48(49-55-56-57-58(49)35-36-19-33-46(61-3)34-20-36)59-50(60)47(51(59)62-52)54-53(43-27-21-40(22-28-43)37-13-7-4-8-14-37,44-29-23-41(24-30-44)38-15-9-5-10-16-38)45-31-25-42(26-32-45)39-17-11-6-12-18-39/h4-34,47-48,51,54H,35H2,1-3H3/t47?,48?,51-/m1/s1 |
| InChIKey | IJLGIYLUOHQJBP-VPKYUHQISA-N |
| XLogP | 10.42 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.06 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|