C34H32N6OS — CID 70605541
(5R)-2-(1-benzyltetrazol-5-yl)-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 70605541) has the molecular formula C34H32N6OS and a molecular weight of 572.74 g/mol. Its IUPAC name is (5R)-2-(1-benzyltetrazol-5-yl)-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (5R)-2-(1-benzyltetrazol-5-yl)-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 70605541 |
| Molecular Formula | C34H32N6OS |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | (5R)-2-(1-benzyltetrazol-5-yl)-3,3-dimethyl-6-(tritylamino)-4-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | CC1(C)S[C@@H]2C(NC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)N2C1c1nnnn1Cc1ccccc1 |
| InChI | InChI=1S/C34H32N6OS/c1-33(2)29(30-36-37-38-39(30)23-24-15-7-3-8-16-24)40-31(41)28(32(40)42-33)35-34(25-17-9-4-10-18-25,26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-22,28-29,32,35H,23H2,1-2H3/t28?,29?,32-/m1/s1 |
| InChIKey | SKNZEWFKBPTPRI-ARDYHYPTSA-N |
| XLogP | 5.41 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|