C20H13F3N4O2 — CID 154326729
1-hydroxy-4-[4-[4-(trifluoromethyl)phenyl]anilino]pyrido[2,3-d]pyrimidin-2-one (PubChem CID 154326729) has the molecular formula C20H13F3N4O2 and a molecular weight of 398.34 g/mol. Its IUPAC name is 1-hydroxy-4-[4-[4-(trifluoromethyl)phenyl]anilino]pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 1-hydroxy-4-[4-[4-(trifluoromethyl)phenyl]anilino]pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 154326729 |
| Molecular Formula | C20H13F3N4O2 |
| Molecular Weight | 398.34 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-hydroxy-4-[4-[4-(trifluoromethyl)phenyl]anilino]pyrido[2,3-d]pyrimidin-2-one |
| SMILES | O=c1nc(Nc2ccc(-c3ccc(C(F)(F)F)cc3)cc2)c2cccnc2n1O |
| InChI | InChI=1S/C20H13F3N4O2/c21-20(22,23)14-7-3-12(4-8-14)13-5-9-15(10-6-13)25-17-16-2-1-11-24-18(16)27(29)19(28)26-17/h1-11,29H,(H,25,26,28) |
| InChIKey | OWDNRVQEPOUWIZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|