C17H17N5O3 — CID 67252249
1-hydroxy-4-(3-morpholin-4-ylanilino)pyrido[2,3-d]pyrimidin-2-one (PubChem CID 67252249) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 1-hydroxy-4-(3-morpholin-4-ylanilino)pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 1-hydroxy-4-(3-morpholin-4-ylanilino)pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 67252249 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-hydroxy-4-(3-morpholin-4-ylanilino)pyrido[2,3-d]pyrimidin-2-one |
| SMILES | O=c1nc(Nc2cccc(N3CCOCC3)c2)c2cccnc2n1O |
| InChI | InChI=1S/C17H17N5O3/c23-17-20-15(14-5-2-6-18-16(14)22(17)24)19-12-3-1-4-13(11-12)21-7-9-25-10-8-21/h1-6,11,24H,7-10H2,(H,19,20,23) |
| InChIKey | BCAMDFSFMUDSCN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|