C17H12N4O3 — CID 91664428
4-[4-(furan-2-yl)anilino]-1-hydroxypyrido[2,3-d]pyrimidin-2-one (PubChem CID 91664428) has the molecular formula C17H12N4O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is 4-[4-(furan-2-yl)anilino]-1-hydroxypyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4-[4-(furan-2-yl)anilino]-1-hydroxypyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 91664428 |
| Molecular Formula | C17H12N4O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 4-[4-(furan-2-yl)anilino]-1-hydroxypyrido[2,3-d]pyrimidin-2-one |
| SMILES | O=c1nc(Nc2ccc(-c3ccco3)cc2)c2cccnc2n1O |
| InChI | InChI=1S/C17H12N4O3/c22-17-20-15(13-3-1-9-18-16(13)21(17)23)19-12-7-5-11(6-8-12)14-4-2-10-24-14/h1-10,23H,(H,19,20,22) |
| InChIKey | WAWJLZSDOMKHFM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|