C16H26N2O2 — CID 15432956
(1S,2R,9S,10R)-2-methoxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one (PubChem CID 15432956) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (1S,2R,9S,10R)-2-methoxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one.
| Compound Name | (1S,2R,9S,10R)-2-methoxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
|---|---|
| PubChem CID | 15432956 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (1S,2R,9S,10R)-2-methoxy-7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecan-6-one |
| SMILES | CO[C@@]12CCCC(=O)N1C[C@@H]1C[C@H]2CN2CCCC[C@H]12 |
| InChI | InChI=1S/C16H26N2O2/c1-20-16-7-4-6-15(19)18(16)10-12-9-13(16)11-17-8-3-2-5-14(12)17/h12-14H,2-11H2,1H3/t12-,13-,14+,16+/m0/s1 |
| InChIKey | BKGPLASQVXPYMX-TTZDDIAXSA-N |
| XLogP | 1.85 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |