C10H9N3O2 — CID 154339751
[2-(1,3-oxazol-5-yl)phenyl]urea (PubChem CID 154339751) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is [2-(1,3-oxazol-5-yl)phenyl]urea.
| Compound Name | [2-(1,3-oxazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 154339751 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | [2-(1,3-oxazol-5-yl)phenyl]urea |
| SMILES | NC(=O)Nc1ccccc1-c1cnco1 |
| InChI | InChI=1S/C10H9N3O2/c11-10(14)13-8-4-2-1-3-7(8)9-5-12-6-15-9/h1-6H,(H3,11,13,14) |
| InChIKey | JFESPACIVYKPGU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |