C5H6Cl3NS — CID 154341468
N-methyl-N-(1,2,2-trichloroethenyl)ethanethioamide (PubChem CID 154341468) has the molecular formula C5H6Cl3NS and a molecular weight of 218.54 g/mol. Its IUPAC name is N-methyl-N-(1,2,2-trichloroethenyl)ethanethioamide.
| Compound Name | N-methyl-N-(1,2,2-trichloroethenyl)ethanethioamide |
|---|---|
| PubChem CID | 154341468 |
| Molecular Formula | C5H6Cl3NS |
| Molecular Weight | 218.54 g/mol |
| Exact Mass | 216.93 |
| IUPAC Name | N-methyl-N-(1,2,2-trichloroethenyl)ethanethioamide |
| SMILES | CC(=S)N(C)C(Cl)=C(Cl)Cl |
| InChI | InChI=1S/C5H6Cl3NS/c1-3(10)9(2)5(8)4(6)7/h1-2H3 |
| InChIKey | ZBXIGIUEYJDRCT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|