C3H2F5O4S- — CID 154351047
1,1,2,3,3-pentafluoro-2-hydroxypropane-1-sulfonate (PubChem CID 154351047) has the molecular formula C3H2F5O4S- and a molecular weight of 229.10 g/mol. Its IUPAC name is 1,1,2,3,3-pentafluoro-2-hydroxypropane-1-sulfonate.
| Compound Name | 1,1,2,3,3-pentafluoro-2-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 154351047 |
| Molecular Formula | C3H2F5O4S- |
| Molecular Weight | 229.10 g/mol |
| Exact Mass | 228.96 |
| IUPAC Name | 1,1,2,3,3-pentafluoro-2-hydroxypropane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(O)(F)C(F)F |
| InChI | InChI=1S/C3H3F5O4S/c4-1(5)2(6,9)3(7,8)13(10,11)12/h1,9H,(H,10,11,12)/p-1 |
| InChIKey | ATWHSCRCSRKANC-UHFFFAOYSA-M |
| XLogP | 0.05 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.10 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|