C11H15N3O2 — CID 154352020
tert-butyl 8H-imidazo[1,5-a]pyrazine-7-carboxylate (PubChem CID 154352020) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is tert-butyl 8H-imidazo[1,5-a]pyrazine-7-carboxylate.
| Compound Name | tert-butyl 8H-imidazo[1,5-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 154352020 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | tert-butyl 8H-imidazo[1,5-a]pyrazine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=Cn2cncc2C1 |
| InChI | InChI=1S/C11H15N3O2/c1-11(2,3)16-10(15)13-4-5-14-8-12-6-9(14)7-13/h4-6,8H,7H2,1-3H3 |
| InChIKey | DEWVNZPPIHCDAT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |