C16H6F9NO4S — CID 154365403
1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl 6-cyanonaphthalene-2-carboxylate (PubChem CID 154365403) has the molecular formula C16H6F9NO4S and a molecular weight of 479.28 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl 6-cyanonaphthalene-2-carboxylate.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl 6-cyanonaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 154365403 |
| Molecular Formula | C16H6F9NO4S |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 478.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl 6-cyanonaphthalene-2-carboxylate |
| SMILES | N#Cc1ccc2cc(C(=O)OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc2c1 |
| InChI | InChI=1S/C16H6F9NO4S/c17-13(18,15(21,22)23)14(19,20)16(24,25)31(28,29)30-12(27)11-4-3-9-5-8(7-26)1-2-10(9)6-11/h1-6H |
| InChIKey | ARMCSYZRIBAAPU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|