C22H46O7Si4 — CID 154372057
2-[4-bis(trimethylsilyloxy)silyloxysilyl-4-methylpentan-2-yl]-3-cyclohexylbut-2-enedioic acid (PubChem CID 154372057) has the molecular formula C22H46O7Si4 and a molecular weight of 534.95 g/mol. Its IUPAC name is 2-[4-bis(trimethylsilyloxy)silyloxysilyl-4-methylpentan-2-yl]-3-cyclohexylbut-2-enedioic acid.
| Compound Name | 2-[4-bis(trimethylsilyloxy)silyloxysilyl-4-methylpentan-2-yl]-3-cyclohexylbut-2-enedioic acid |
|---|---|
| PubChem CID | 154372057 |
| Molecular Formula | C22H46O7Si4 |
| Molecular Weight | 534.95 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 2-[4-bis(trimethylsilyloxy)silyloxysilyl-4-methylpentan-2-yl]-3-cyclohexylbut-2-enedioic acid |
| SMILES | CC(CC(C)(C)[SiH2]O[SiH](O[Si](C)(C)C)O[Si](C)(C)C)C(C(=O)O)=C(C(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C22H46O7Si4/c1-16(18(20(23)24)19(21(25)26)17-13-11-10-12-14-17)15-22(2,3)30-27-31(28-32(4,5)6)29-33(7,8)9/h16-17,31H,10-15,30H2,1-9H3,(H,23,24)(H,25,26) |
| InChIKey | FVKUHZWKFLRJJX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.95 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|