C13H15BO3 — CID 154372576
2-(4,5,5-trimethyl-2-phenyl-1,3,2-dioxaborolan-4-yl)ethenone (PubChem CID 154372576) has the molecular formula C13H15BO3 and a molecular weight of 230.07 g/mol. Its IUPAC name is 2-(4,5,5-trimethyl-2-phenyl-1,3,2-dioxaborolan-4-yl)ethenone.
| Compound Name | 2-(4,5,5-trimethyl-2-phenyl-1,3,2-dioxaborolan-4-yl)ethenone |
|---|---|
| PubChem CID | 154372576 |
| Molecular Formula | C13H15BO3 |
| Molecular Weight | 230.07 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-(4,5,5-trimethyl-2-phenyl-1,3,2-dioxaborolan-4-yl)ethenone |
| SMILES | CC1(C)OB(c2ccccc2)OC1(C)C=C=O |
| InChI | InChI=1S/C13H15BO3/c1-12(2)13(3,9-10-15)17-14(16-12)11-7-5-4-6-8-11/h4-9H,1-3H3 |
| InChIKey | HGMIWKAJLCMSRE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.07 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|