About 2-ethyl-4-methylazulene
2-ethyl-4-methylazulene (PubChem CID 154376639) has the molecular formula C13H14
and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-ethyl-4-methylazulene.
Molecular Properties
| Compound Name | 2-ethyl-4-methylazulene |
| PubChem CID | 154376639 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-ethyl-4-methylazulene |
| SMILES | CCc1cc2ccccc(C)c-2c1 |
| InChI | InChI=1S/C13H14/c1-3-11-8-12-7-5-4-6-10(2)13(12)9-11/h4-9H,3H2,1-2H3 |
| InChIKey | UFBYZINNXJQMJP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-ethyl-4-methylazulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-methylazulene?
The IUPAC name of 2-ethyl-4-methylazulene (CID 154376639) is 2-ethyl-4-methylazulene.
What is the SMILES notation for 2-ethyl-4-methylazulene?
The canonical SMILES for 2-ethyl-4-methylazulene is CCc1cc2ccccc(C)c-2c1.
What is the InChIKey of 2-ethyl-4-methylazulene?
The InChIKey is UFBYZINNXJQMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14/c1-3-11-8-12-7-5-4-6-10(2)13(12)9-11/h4-9H,3H2,1-2H3.
What are the key properties of 2-ethyl-4-methylazulene?
2-ethyl-4-methylazulene has a molecular weight of 170.25 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-methylazulene is sourced from PubChem (CID 154376639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).