5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid

C12H21NO3S2 — CID 154385337

IUPAC5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid
SMILESCCCCC(CC)Cc1sc(S(=O)(=O)O)nc1C
InChIInChI=1S/C12H21NO3S2/c1-4-6-7-10(5-2)8-11-9(3)13-12(17-11)18(14,15)16/h10H,4-8H2,1-3H3,(H,14,15,16)
InChIKeyFOZFNZOREUDDMS-UHFFFAOYSA-N
MW291.44 g/mol
LogP3.46
Rot. Bonds7

About 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid

5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid (PubChem CID 154385337) has the molecular formula C12H21NO3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid.

Molecular Properties

Compound Name5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid
PubChem CID154385337
Molecular FormulaC12H21NO3S2
Molecular Weight291.44 g/mol
Exact Mass291.10
IUPAC Name5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid
SMILESCCCCC(CC)Cc1sc(S(=O)(=O)O)nc1C
InChIInChI=1S/C12H21NO3S2/c1-4-6-7-10(5-2)8-11-9(3)13-12(17-11)18(14,15)16/h10H,4-8H2,1-3H3,(H,14,15,16)
InChIKeyFOZFNZOREUDDMS-UHFFFAOYSA-N
XLogP3.46
TPSA67.26 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.44
LogP ≤ 53.46
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid?
The IUPAC name of 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid (CID 154385337) is 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid.
What is the SMILES notation for 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid?
The canonical SMILES for 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid is CCCCC(CC)Cc1sc(S(=O)(=O)O)nc1C.
What is the InChIKey of 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid?
The InChIKey is FOZFNZOREUDDMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3S2/c1-4-6-7-10(5-2)8-11-9(3)13-12(17-11)18(14,15)16/h10H,4-8H2,1-3H3,(H,14,15,16).
What are the key properties of 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid?
5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid has a molecular weight of 291.44 g/mol, XLogP of 3.46, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid is sourced from PubChem (CID 154385337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).