C12H21NO3S2 — CID 154385337
5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid (PubChem CID 154385337) has the molecular formula C12H21NO3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid.
| Compound Name | 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid |
|---|---|
| PubChem CID | 154385337 |
| Molecular Formula | C12H21NO3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 5-(2-ethylhexyl)-4-methyl-1,3-thiazole-2-sulfonic acid |
| SMILES | CCCCC(CC)Cc1sc(S(=O)(=O)O)nc1C |
| InChI | InChI=1S/C12H21NO3S2/c1-4-6-7-10(5-2)8-11-9(3)13-12(17-11)18(14,15)16/h10H,4-8H2,1-3H3,(H,14,15,16) |
| InChIKey | FOZFNZOREUDDMS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|