C10H17N3O5S2 — CID 154394583
2-amino-5-butoxybenzene-1,4-disulfonamide (PubChem CID 154394583) has the molecular formula C10H17N3O5S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-amino-5-butoxybenzene-1,4-disulfonamide.
| Compound Name | 2-amino-5-butoxybenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 154394583 |
| Molecular Formula | C10H17N3O5S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-amino-5-butoxybenzene-1,4-disulfonamide |
| SMILES | CCCCOc1cc(S(N)(=O)=O)c(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C10H17N3O5S2/c1-2-3-4-18-8-6-9(19(12,14)15)7(11)5-10(8)20(13,16)17/h5-6H,2-4,11H2,1H3,(H2,12,14,15)(H2,13,16,17) |
| InChIKey | JATGCWRNFHSNQT-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 155.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|