C7H17N5 — CID 154399109
5-(1-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine (PubChem CID 154399109) has the molecular formula C7H17N5 and a molecular weight of 171.25 g/mol. Its IUPAC name is 5-(1-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine.
| Compound Name | 5-(1-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine |
|---|---|
| PubChem CID | 154399109 |
| Molecular Formula | C7H17N5 |
| Molecular Weight | 171.25 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | 5-(1-aminoethyl)-1,3-dimethyl-3H-pyrazole-2,4-diamine |
| SMILES | CC(N)C1=C(N)C(C)N(N)N1C |
| InChI | InChI=1S/C7H17N5/c1-4(8)7-6(9)5(2)12(10)11(7)3/h4-5H,8-10H2,1-3H3 |
| InChIKey | AAFKAIOFRJVBEP-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.25 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|