About 1,2-diisothiocyanatohexane
1,2-diisothiocyanatohexane (PubChem CID 154401997) has the molecular formula C8H12N2S2
and a molecular weight of 200.33 g/mol. Its IUPAC name is 1,2-diisothiocyanatohexane.
Molecular Properties
| Compound Name | 1,2-diisothiocyanatohexane |
| PubChem CID | 154401997 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1,2-diisothiocyanatohexane |
| SMILES | CCCCC(CN=C=S)N=C=S |
| InChI | InChI=1S/C8H12N2S2/c1-2-3-4-8(10-7-12)5-9-6-11/h8H,2-5H2,1H3 |
| InChIKey | ISKKRMPDHBNDGG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diisothiocyanatohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diisothiocyanatohexane?
The IUPAC name of 1,2-diisothiocyanatohexane (CID 154401997) is 1,2-diisothiocyanatohexane.
What is the SMILES notation for 1,2-diisothiocyanatohexane?
The canonical SMILES for 1,2-diisothiocyanatohexane is CCCCC(CN=C=S)N=C=S.
What is the InChIKey of 1,2-diisothiocyanatohexane?
The InChIKey is ISKKRMPDHBNDGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S2/c1-2-3-4-8(10-7-12)5-9-6-11/h8H,2-5H2,1H3.
What are the key properties of 1,2-diisothiocyanatohexane?
1,2-diisothiocyanatohexane has a molecular weight of 200.33 g/mol, XLogP of 2.75, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diisothiocyanatohexane is sourced from PubChem (CID 154401997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).