C22H40F2O3Si — CID 154402222
tert-butyl-[[(5R,6S,7S,8E)-13,13-difluoro-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]-dimethylsilane (PubChem CID 154402222) has the molecular formula C22H40F2O3Si and a molecular weight of 418.64 g/mol. Its IUPAC name is tert-butyl-[[(5R,6S,7S,8E)-13,13-difluoro-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(5R,6S,7S,8E)-13,13-difluoro-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 154402222 |
| Molecular Formula | C22H40F2O3Si |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | tert-butyl-[[(5R,6S,7S,8E)-13,13-difluoro-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]-dimethylsilane |
| SMILES | CO[C@H]1/C=C/CCCC(F)(F)COCC(C)=C[C@@H](C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40F2O3Si/c1-17-14-18(2)20(27-28(7,8)21(3,4)5)19(25-6)12-10-9-11-13-22(23,24)16-26-15-17/h10,12,14,18-20H,9,11,13,15-16H2,1-8H3/b12-10+,17-14?/t18-,19+,20+/m1/s1 |
| InChIKey | WWVFENPHCSKTRJ-HMXIXKMTSA-N |
| XLogP | 6.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|