C22H29N3O2 — CID 154404255
tert-butyl 4-[3-[2-(1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]but-2-enoate (PubChem CID 154404255) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl 4-[3-[2-(1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]but-2-enoate.
| Compound Name | tert-butyl 4-[3-[2-(1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 154404255 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | tert-butyl 4-[3-[2-(1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-yl]but-2-enoate |
| SMILES | CC(C)(C)OC(=O)C=CCN1CCC(CCc2ccc3cccnc3n2)C1 |
| InChI | InChI=1S/C22H29N3O2/c1-22(2,3)27-20(26)7-5-14-25-15-12-17(16-25)8-10-19-11-9-18-6-4-13-23-21(18)24-19/h4-7,9,11,13,17H,8,10,12,14-16H2,1-3H3 |
| InChIKey | GVFKFBQIDHYZEE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|