C27H25N5O2S — CID 154407612
4-morpholin-4-yl-6-[7-(pyrimidin-5-ylmethylamino)-9H-thioxanthen-4-yl]-1H-pyridin-2-one (PubChem CID 154407612) has the molecular formula C27H25N5O2S and a molecular weight of 483.60 g/mol. Its IUPAC name is 4-morpholin-4-yl-6-[7-(pyrimidin-5-ylmethylamino)-9H-thioxanthen-4-yl]-1H-pyridin-2-one.
| Compound Name | 4-morpholin-4-yl-6-[7-(pyrimidin-5-ylmethylamino)-9H-thioxanthen-4-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 154407612 |
| Molecular Formula | C27H25N5O2S |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 4-morpholin-4-yl-6-[7-(pyrimidin-5-ylmethylamino)-9H-thioxanthen-4-yl]-1H-pyridin-2-one |
| SMILES | O=c1cc(N2CCOCC2)cc(-c2cccc3c2Sc2ccc(NCc4cncnc4)cc2C3)[nH]1 |
| InChI | InChI=1S/C27H25N5O2S/c33-26-13-22(32-6-8-34-9-7-32)12-24(31-26)23-3-1-2-19-10-20-11-21(4-5-25(20)35-27(19)23)30-16-18-14-28-17-29-15-18/h1-5,11-15,17,30H,6-10,16H2,(H,31,33) |
| InChIKey | QPMCJNWWAWXPSB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |