C22H14O10 — CID 154412145
4-[3-(2,4-dicarboxyphenyl)-2,4-dihydroxyphenyl]benzene-1,3-dicarboxylic acid (PubChem CID 154412145) has the molecular formula C22H14O10 and a molecular weight of 438.34 g/mol. Its IUPAC name is 4-[3-(2,4-dicarboxyphenyl)-2,4-dihydroxyphenyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[3-(2,4-dicarboxyphenyl)-2,4-dihydroxyphenyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 154412145 |
| Molecular Formula | C22H14O10 |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 4-[3-(2,4-dicarboxyphenyl)-2,4-dihydroxyphenyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(O)c(-c3ccc(C(=O)O)cc3C(=O)O)c2O)c(C(=O)O)c1 |
| InChI | InChI=1S/C22H14O10/c23-16-6-5-13(11-3-1-9(19(25)26)7-14(11)21(29)30)18(24)17(16)12-4-2-10(20(27)28)8-15(12)22(31)32/h1-8,23-24H,(H,25,26)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | NHRDJRKHEGAIGO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |