C11H15N3OS — CID 154429031
3-morpholin-4-yl-2H-1,3-benzothiazol-6-amine (PubChem CID 154429031) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 3-morpholin-4-yl-2H-1,3-benzothiazol-6-amine.
| Compound Name | 3-morpholin-4-yl-2H-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 154429031 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 3-morpholin-4-yl-2H-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2c(c1)SCN2N1CCOCC1 |
| InChI | InChI=1S/C11H15N3OS/c12-9-1-2-10-11(7-9)16-8-14(10)13-3-5-15-6-4-13/h1-2,7H,3-6,8,12H2 |
| InChIKey | QDSPFJJDTUWRCI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|