C23H19Cl2NZr — CID 154434272
cyclopenta-1,3-diene;dichlorozirconium(2+);1-(1H-inden-1-id-2-yl)-2-methylindole (PubChem CID 154434272) has the molecular formula C23H19Cl2NZr and a molecular weight of 471.54 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dichlorozirconium(2+);1-(1H-inden-1-id-2-yl)-2-methylindole.
| Compound Name | cyclopenta-1,3-diene;dichlorozirconium(2+);1-(1H-inden-1-id-2-yl)-2-methylindole |
|---|---|
| PubChem CID | 154434272 |
| Molecular Formula | C23H19Cl2NZr |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | cyclopenta-1,3-diene;dichlorozirconium(2+);1-(1H-inden-1-id-2-yl)-2-methylindole |
| SMILES | Cc1cc2ccccc2n1-c1cc2ccccc2[cH-]1.Cl[Zr+2]Cl.c1cc[cH-]c1 |
| InChI | InChI=1S/C18H14N.C5H5.2ClH.Zr/c1-13-10-16-8-4-5-9-18(16)19(13)17-11-14-6-2-3-7-15(14)12-17;1-2-4-5-3-1;;;/h2-12H,1H3;1-5H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | SAIXFYQIQZLVIC-UHFFFAOYSA-L |
| XLogP | 7.59 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|