C19H11ClF3N4O3- — CID 154437203
5-(4-chlorophenyl)-3-[[4-(trifluoromethyl)anilino]carbamoyl]pyrazine-2-carboxylate (PubChem CID 154437203) has the molecular formula C19H11ClF3N4O3- and a molecular weight of 435.77 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[[4-(trifluoromethyl)anilino]carbamoyl]pyrazine-2-carboxylate.
| Compound Name | 5-(4-chlorophenyl)-3-[[4-(trifluoromethyl)anilino]carbamoyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 154437203 |
| Molecular Formula | C19H11ClF3N4O3- |
| Molecular Weight | 435.77 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[[4-(trifluoromethyl)anilino]carbamoyl]pyrazine-2-carboxylate |
| SMILES | O=C([O-])c1ncc(-c2ccc(Cl)cc2)nc1C(=O)NNc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H12ClF3N4O3/c20-12-5-1-10(2-6-12)14-9-24-16(18(29)30)15(25-14)17(28)27-26-13-7-3-11(4-8-13)19(21,22)23/h1-9,26H,(H,27,28)(H,29,30)/p-1 |
| InChIKey | UGLCXFUTNBMILK-UHFFFAOYSA-M |
| XLogP | 2.94 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.77 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|