About 1-propan-2-yloxysilinane
1-propan-2-yloxysilinane (PubChem CID 154441011) has the molecular formula C8H18OSi
and a molecular weight of 158.32 g/mol. Its IUPAC name is 1-propan-2-yloxysilinane.
Molecular Properties
| Compound Name | 1-propan-2-yloxysilinane |
| PubChem CID | 154441011 |
| Molecular Formula | C8H18OSi |
| Molecular Weight | 158.32 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 1-propan-2-yloxysilinane |
| SMILES | CC(C)O[SiH]1CCCCC1 |
| InChI | InChI=1S/C8H18OSi/c1-8(2)9-10-6-4-3-5-7-10/h8,10H,3-7H2,1-2H3 |
| InChIKey | QBNFMOLKFUOLTC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yloxysilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yloxysilinane?
The IUPAC name of 1-propan-2-yloxysilinane (CID 154441011) is 1-propan-2-yloxysilinane.
What is the SMILES notation for 1-propan-2-yloxysilinane?
The canonical SMILES for 1-propan-2-yloxysilinane is CC(C)O[SiH]1CCCCC1.
What is the InChIKey of 1-propan-2-yloxysilinane?
The InChIKey is QBNFMOLKFUOLTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18OSi/c1-8(2)9-10-6-4-3-5-7-10/h8,10H,3-7H2,1-2H3.
What are the key properties of 1-propan-2-yloxysilinane?
1-propan-2-yloxysilinane has a molecular weight of 158.32 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yloxysilinane is sourced from PubChem (CID 154441011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).