C16H19N3O5S — CID 154442351
3-[3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylphenyl]-3-hydroxy-2-methanimidoyl-N-methylprop-2-enamide (PubChem CID 154442351) has the molecular formula C16H19N3O5S and a molecular weight of 365.41 g/mol. Its IUPAC name is 3-[3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylphenyl]-3-hydroxy-2-methanimidoyl-N-methylprop-2-enamide.
| Compound Name | 3-[3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylphenyl]-3-hydroxy-2-methanimidoyl-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 154442351 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 3-[3-(4,5-dihydro-1,2-oxazol-3-yl)-2-methyl-4-methylsulfonylphenyl]-3-hydroxy-2-methanimidoyl-N-methylprop-2-enamide |
| SMILES | [H]/N=C/C(C(=O)NC)=C(O)c1ccc(S(C)(=O)=O)c(C2=NOCC2)c1C |
| InChI | InChI=1S/C16H19N3O5S/c1-9-10(15(20)11(8-17)16(21)18-2)4-5-13(25(3,22)23)14(9)12-6-7-24-19-12/h4-5,8,17,20H,6-7H2,1-3H3,(H,18,21)/b15-11?,17-8+ |
| InChIKey | BZWKLCFRKZPELE-RFCAGVDVSA-N |
| XLogP | 1.19 |
| TPSA | 128.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|