C22H36O2SSi — CID 154455051
S-benzyl 2-[tert-butyl(dimethyl)silyl]oxynon-4-enethioate (PubChem CID 154455051) has the molecular formula C22H36O2SSi and a molecular weight of 392.68 g/mol. Its IUPAC name is S-benzyl 2-[tert-butyl(dimethyl)silyl]oxynon-4-enethioate.
| Compound Name | S-benzyl 2-[tert-butyl(dimethyl)silyl]oxynon-4-enethioate |
|---|---|
| PubChem CID | 154455051 |
| Molecular Formula | C22H36O2SSi |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | S-benzyl 2-[tert-butyl(dimethyl)silyl]oxynon-4-enethioate |
| SMILES | CCCCC=CCC(O[Si](C)(C)C(C)(C)C)C(=O)SCc1ccccc1 |
| InChI | InChI=1S/C22H36O2SSi/c1-7-8-9-10-14-17-20(24-26(5,6)22(2,3)4)21(23)25-18-19-15-12-11-13-16-19/h10-16,20H,7-9,17-18H2,1-6H3 |
| InChIKey | GPJBCWKEYSBSHP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|