C21H26OSSi — CID 154716144
S-ethyl (E,3R)-3-[dimethyl(phenyl)silyl]-5-phenylpent-4-enethioate (PubChem CID 154716144) has the molecular formula C21H26OSSi and a molecular weight of 354.59 g/mol. Its IUPAC name is S-ethyl (E,3R)-3-[dimethyl(phenyl)silyl]-5-phenylpent-4-enethioate.
| Compound Name | S-ethyl (E,3R)-3-[dimethyl(phenyl)silyl]-5-phenylpent-4-enethioate |
|---|---|
| PubChem CID | 154716144 |
| Molecular Formula | C21H26OSSi |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | S-ethyl (E,3R)-3-[dimethyl(phenyl)silyl]-5-phenylpent-4-enethioate |
| SMILES | CCSC(=O)CC(/C=C/c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H26OSSi/c1-4-23-21(22)17-20(16-15-18-11-7-5-8-12-18)24(2,3)19-13-9-6-10-14-19/h5-16,20H,4,17H2,1-3H3/b16-15+ |
| InChIKey | KWLSMZDAWJEMDJ-FOCLMDBBSA-N |
| XLogP | 5.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|