C19H30O3SSi — CID 134931190
S-ethyl (E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-phenylpent-4-enethioate (PubChem CID 134931190) has the molecular formula C19H30O3SSi and a molecular weight of 366.60 g/mol. Its IUPAC name is S-ethyl (E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-phenylpent-4-enethioate.
| Compound Name | S-ethyl (E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-phenylpent-4-enethioate |
|---|---|
| PubChem CID | 134931190 |
| Molecular Formula | C19H30O3SSi |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | S-ethyl (E,2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-5-phenylpent-4-enethioate |
| SMILES | CCSC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H30O3SSi/c1-7-23-18(21)17(22-24(5,6)19(2,3)4)16(20)14-13-15-11-9-8-10-12-15/h8-14,16-17,20H,7H2,1-6H3/b14-13+/t16-,17-/m1/s1 |
| InChIKey | VEUXBFJUKRSQCR-UEWLMQCVSA-N |
| XLogP | 4.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|