C19H20O2S — CID 134904531
S-benzyl (E,2S,3S)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate (PubChem CID 134904531) has the molecular formula C19H20O2S and a molecular weight of 312.43 g/mol. Its IUPAC name is S-benzyl (E,2S,3S)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate.
| Compound Name | S-benzyl (E,2S,3S)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate |
|---|---|
| PubChem CID | 134904531 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | S-benzyl (E,2S,3S)-3-hydroxy-2-methyl-5-phenylpent-4-enethioate |
| SMILES | C[C@H](C(=O)SCc1ccccc1)[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H20O2S/c1-15(18(20)13-12-16-8-4-2-5-9-16)19(21)22-14-17-10-6-3-7-11-17/h2-13,15,18,20H,14H2,1H3/b13-12+/t15-,18-/m0/s1 |
| InChIKey | ZNEZFOZKURBJEY-IXUWUVECSA-N |
| XLogP | 4.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|