C12H11F3NO5S- — CID 154461651
5-(trifluoromethylsulfonyloxy)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (PubChem CID 154461651) has the molecular formula C12H11F3NO5S- and a molecular weight of 338.28 g/mol. Its IUPAC name is 5-(trifluoromethylsulfonyloxy)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate.
| Compound Name | 5-(trifluoromethylsulfonyloxy)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
|---|---|
| PubChem CID | 154461651 |
| Molecular Formula | C12H11F3NO5S- |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 5-(trifluoromethylsulfonyloxy)-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| SMILES | O=C([O-])N1CCc2ccccc2C(OS(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H12F3NO5S/c13-12(14,15)22(19,20)21-10-7-16(11(17)18)6-5-8-3-1-2-4-9(8)10/h1-4,10H,5-7H2,(H,17,18)/p-1 |
| InChIKey | CVYFGLBXANFHNM-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|