C13H12F3NO6S — CID 158841095
1-(trifluoromethylsulfonyloxy)-3,3a,5,9b-tetrahydro-1H-isochromeno[3,4-c]pyrrole-2-carboxylic acid (PubChem CID 158841095) has the molecular formula C13H12F3NO6S and a molecular weight of 367.30 g/mol. Its IUPAC name is 1-(trifluoromethylsulfonyloxy)-3,3a,5,9b-tetrahydro-1H-isochromeno[3,4-c]pyrrole-2-carboxylic acid.
| Compound Name | 1-(trifluoromethylsulfonyloxy)-3,3a,5,9b-tetrahydro-1H-isochromeno[3,4-c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 158841095 |
| Molecular Formula | C13H12F3NO6S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 1-(trifluoromethylsulfonyloxy)-3,3a,5,9b-tetrahydro-1H-isochromeno[3,4-c]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)N1CC2OCc3ccccc3C2C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO6S/c14-13(15,16)24(20,21)23-11-10-8-4-2-1-3-7(8)6-22-9(10)5-17(11)12(18)19/h1-4,9-11H,5-6H2,(H,18,19) |
| InChIKey | IYGHCDQZLJYLBF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|