C10H9F3O4S — CID 107149907
3,4-dihydro-1H-isochromen-4-yl trifluoromethanesulfonate (PubChem CID 107149907) has the molecular formula C10H9F3O4S and a molecular weight of 282.24 g/mol. Its IUPAC name is 3,4-dihydro-1H-isochromen-4-yl trifluoromethanesulfonate.
| Compound Name | 3,4-dihydro-1H-isochromen-4-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 107149907 |
| Molecular Formula | C10H9F3O4S |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 3,4-dihydro-1H-isochromen-4-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1COCc2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C10H9F3O4S/c11-10(12,13)18(14,15)17-9-6-16-5-7-3-1-2-4-8(7)9/h1-4,9H,5-6H2 |
| InChIKey | HROPPXLHBJNMJW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|