C18H14F3NO5S — CID 159229263
(2,5-dioxopyrrolidin-3-yl) trifluoromethanesulfonate;9H-fluorene (PubChem CID 159229263) has the molecular formula C18H14F3NO5S and a molecular weight of 413.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-3-yl) trifluoromethanesulfonate;9H-fluorene.
| Compound Name | (2,5-dioxopyrrolidin-3-yl) trifluoromethanesulfonate;9H-fluorene |
|---|---|
| PubChem CID | 159229263 |
| Molecular Formula | C18H14F3NO5S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-3-yl) trifluoromethanesulfonate;9H-fluorene |
| SMILES | O=C1CC(OS(=O)(=O)C(F)(F)F)C(=O)N1.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10.C5H4F3NO5S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;6-5(7,8)15(12,13)14-2-1-3(10)9-4(2)11/h1-8H,9H2;2H,1H2,(H,9,10,11) |
| InChIKey | KSRLNJLCOQZWHY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|