C20H18O4 — CID 154464837
phenanthren-3-yl 2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 154464837) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is phenanthren-3-yl 2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | phenanthren-3-yl 2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 154464837 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | phenanthren-3-yl 2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CC1(C)OCC(C(=O)Oc2ccc3ccc4ccccc4c3c2)O1 |
| InChI | InChI=1S/C20H18O4/c1-20(2)22-12-18(24-20)19(21)23-15-10-9-14-8-7-13-5-3-4-6-16(13)17(14)11-15/h3-11,18H,12H2,1-2H3 |
| InChIKey | MCLPGRDSFRGNHK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|