About 6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene
6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene (PubChem CID 154473465) has the molecular formula C9H12F2
and a molecular weight of 158.19 g/mol. Its IUPAC name is 6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene.
Analyze 6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene?
The IUPAC name of 6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene (CID 154473465) is 6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for 6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene?
The canonical SMILES for 6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene is CC1(C)C=CC=CC1C(F)F.
What is the InChIKey of 6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene?
The InChIKey is IHQVMALNNWYAFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2/c1-9(2)6-4-3-5-7(9)8(10)11/h3-8H,1-2H3.
What are the key properties of 6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene?
6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene has a molecular weight of 158.19 g/mol, XLogP of 3.02, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(difluoromethyl)-5,5-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 154473465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).