About 4-fluoro-3,3-dimethylcyclobutene
4-fluoro-3,3-dimethylcyclobutene (PubChem CID 174786125) has the molecular formula C6H9F
and a molecular weight of 100.14 g/mol. Its IUPAC name is 4-fluoro-3,3-dimethylcyclobutene.
Molecular Properties
| Compound Name | 4-fluoro-3,3-dimethylcyclobutene |
| PubChem CID | 174786125 |
| Molecular Formula | C6H9F |
| Molecular Weight | 100.14 g/mol |
| Exact Mass | 100.07 |
| IUPAC Name | 4-fluoro-3,3-dimethylcyclobutene |
| SMILES | CC1(C)C=CC1F |
| InChI | InChI=1S/C6H9F/c1-6(2)4-3-5(6)7/h3-5H,1-2H3 |
| InChIKey | WKFFZOIYZGSTBD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.14 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-3,3-dimethylcyclobutene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3,3-dimethylcyclobutene?
The IUPAC name of 4-fluoro-3,3-dimethylcyclobutene (CID 174786125) is 4-fluoro-3,3-dimethylcyclobutene.
What is the SMILES notation for 4-fluoro-3,3-dimethylcyclobutene?
The canonical SMILES for 4-fluoro-3,3-dimethylcyclobutene is CC1(C)C=CC1F.
What is the InChIKey of 4-fluoro-3,3-dimethylcyclobutene?
The InChIKey is WKFFZOIYZGSTBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F/c1-6(2)4-3-5(6)7/h3-5H,1-2H3.
What are the key properties of 4-fluoro-3,3-dimethylcyclobutene?
4-fluoro-3,3-dimethylcyclobutene has a molecular weight of 100.14 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3,3-dimethylcyclobutene is sourced from PubChem (CID 174786125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).