C6H9F — CID 174786125
4-fluoro-3,3-dimethylcyclobutene (PubChem CID 174786125) has the molecular formula C6H9F and a molecular weight of 100.14 g/mol. Its IUPAC name is 4-fluoro-3,3-dimethylcyclobutene.
| Compound Name | 4-fluoro-3,3-dimethylcyclobutene |
|---|---|
| PubChem CID | 174786125 |
| Molecular Formula | C6H9F |
| Molecular Weight | 100.14 g/mol |
| Exact Mass | 100.07 |
| IUPAC Name | 4-fluoro-3,3-dimethylcyclobutene |
| SMILES | CC1(C)C=CC1F |
| InChI | InChI=1S/C6H9F/c1-6(2)4-3-5(6)7/h3-5H,1-2H3 |
| InChIKey | WKFFZOIYZGSTBD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.14 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|