C9H10 — CID 15328759
5-(1-methylcycloprop-2-en-1-yl)cyclopenta-1,3-diene (PubChem CID 15328759) has the molecular formula C9H10 and a molecular weight of 118.18 g/mol. Its IUPAC name is 5-(1-methylcycloprop-2-en-1-yl)cyclopenta-1,3-diene.
| Compound Name | 5-(1-methylcycloprop-2-en-1-yl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 15328759 |
| Molecular Formula | C9H10 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 5-(1-methylcycloprop-2-en-1-yl)cyclopenta-1,3-diene |
| SMILES | CC1(C2C=CC=C2)C=C1 |
| InChI | InChI=1S/C9H10/c1-9(6-7-9)8-4-2-3-5-8/h2-8H,1H3 |
| InChIKey | JENVGORXBRDRPG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|