C25H20ClF7N2O4 — CID 154480537
3-[2-chloro-3,3-difluoro-3-(2,2,3,3,3-pentafluoropropoxy)prop-1-enyl]-1-[cyano-(3-pyridin-2-yloxyphenyl)methyl]-2,2-dimethylcyclopropane-1-carboxylic acid (PubChem CID 154480537) has the molecular formula C25H20ClF7N2O4 and a molecular weight of 580.88 g/mol. Its IUPAC name is 3-[2-chloro-3,3-difluoro-3-(2,2,3,3,3-pentafluoropropoxy)prop-1-enyl]-1-[cyano-(3-pyridin-2-yloxyphenyl)methyl]-2,2-dimethylcyclopropane-1-carboxylic acid.
| Compound Name | 3-[2-chloro-3,3-difluoro-3-(2,2,3,3,3-pentafluoropropoxy)prop-1-enyl]-1-[cyano-(3-pyridin-2-yloxyphenyl)methyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 154480537 |
| Molecular Formula | C25H20ClF7N2O4 |
| Molecular Weight | 580.88 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | 3-[2-chloro-3,3-difluoro-3-(2,2,3,3,3-pentafluoropropoxy)prop-1-enyl]-1-[cyano-(3-pyridin-2-yloxyphenyl)methyl]-2,2-dimethylcyclopropane-1-carboxylic acid |
| SMILES | CC1(C)C(C=C(Cl)C(F)(F)OCC(F)(F)C(F)(F)F)C1(C(=O)O)C(C#N)c1cccc(Oc2ccccn2)c1 |
| InChI | InChI=1S/C25H20ClF7N2O4/c1-21(2)17(11-18(26)24(29,30)38-13-22(27,28)25(31,32)33)23(21,20(36)37)16(12-34)14-6-5-7-15(10-14)39-19-8-3-4-9-35-19/h3-11,16-17H,13H2,1-2H3,(H,36,37) |
| InChIKey | MSPSEUSHXWLWST-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.88 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|