C54H36 — CID 15448877
(9R,18R,27R)-9,18,27-tris[(2-ethynylphenyl)methyl]heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene (PubChem CID 15448877) has the molecular formula C54H36 and a molecular weight of 684.88 g/mol. Its IUPAC name is (9R,18R,27R)-9,18,27-tris[(2-ethynylphenyl)methyl]heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene.
| Compound Name | (9R,18R,27R)-9,18,27-tris[(2-ethynylphenyl)methyl]heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene |
|---|---|
| PubChem CID | 15448877 |
| Molecular Formula | C54H36 |
| Molecular Weight | 684.88 g/mol |
| Exact Mass | 684.28 |
| IUPAC Name | (9R,18R,27R)-9,18,27-tris[(2-ethynylphenyl)methyl]heptacyclo[18.7.0.02,10.03,8.011,19.012,17.021,26]heptacosa-1,3,5,7,10,12,14,16,19,21,23,25-dodecaene |
| SMILES | C#Cc1ccccc1C[C@@H]1c2ccccc2-c2c1c1c(c3c2[C@H](Cc2ccccc2C#C)c2ccccc2-3)[C@H](Cc2ccccc2C#C)c2ccccc2-1 |
| InChI | InChI=1S/C54H36/c1-4-34-19-7-10-22-37(34)31-46-40-25-13-16-28-43(40)49-52(46)50-44-29-17-14-26-41(44)47(32-38-23-11-8-20-35(38)5-2)54(50)51-45-30-18-15-27-42(45)48(53(49)51)33-39-24-12-9-21-36(39)6-3/h1-3,7-30,46-48H,31-33H2/t46-,47-,48-/m1/s1 |
| InChIKey | DWDSIDVHAHCDIU-VJOZVQJDSA-N |
| XLogP | 11.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.88 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|