C10H10F3N3O — CID 154498680
phenyl N-(aminomethylidene)-N'-(2,2,2-trifluoroethyl)carbamimidate (PubChem CID 154498680) has the molecular formula C10H10F3N3O and a molecular weight of 245.20 g/mol. Its IUPAC name is phenyl N-(aminomethylidene)-N'-(2,2,2-trifluoroethyl)carbamimidate.
| Compound Name | phenyl N-(aminomethylidene)-N'-(2,2,2-trifluoroethyl)carbamimidate |
|---|---|
| PubChem CID | 154498680 |
| Molecular Formula | C10H10F3N3O |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | phenyl N-(aminomethylidene)-N'-(2,2,2-trifluoroethyl)carbamimidate |
| SMILES | NC=N/C(=N\CC(F)(F)F)Oc1ccccc1 |
| InChI | InChI=1S/C10H10F3N3O/c11-10(12,13)6-15-9(16-7-14)17-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,14,15,16) |
| InChIKey | SNOSFTKZIAKRQF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|