C8H15F2N — CID 154500853
(E)-1,1-difluoro-6-methylhept-2-en-4-amine (PubChem CID 154500853) has the molecular formula C8H15F2N and a molecular weight of 163.21 g/mol. Its IUPAC name is (E)-1,1-difluoro-6-methylhept-2-en-4-amine.
| Compound Name | (E)-1,1-difluoro-6-methylhept-2-en-4-amine |
|---|---|
| PubChem CID | 154500853 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | (E)-1,1-difluoro-6-methylhept-2-en-4-amine |
| SMILES | CC(C)CC(N)/C=C/C(F)F |
| InChI | InChI=1S/C8H15F2N/c1-6(2)5-7(11)3-4-8(9)10/h3-4,6-8H,5,11H2,1-2H3/b4-3+ |
| InChIKey | FOAPQCUSSMHFNE-ONEGZZNKSA-N |
| XLogP | 2.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|