About ethyl 4-dimethylsilylbutanoate
ethyl 4-dimethylsilylbutanoate (PubChem CID 154502277) has the molecular formula C8H18O2Si
and a molecular weight of 174.32 g/mol. Its IUPAC name is ethyl 4-dimethylsilylbutanoate.
Molecular Properties
| Compound Name | ethyl 4-dimethylsilylbutanoate |
| PubChem CID | 154502277 |
| Molecular Formula | C8H18O2Si |
| Molecular Weight | 174.32 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | ethyl 4-dimethylsilylbutanoate |
| SMILES | CCOC(=O)CCC[SiH](C)C |
| InChI | InChI=1S/C8H18O2Si/c1-4-10-8(9)6-5-7-11(2)3/h11H,4-7H2,1-3H3 |
| InChIKey | AKSGIFZZBBVHOH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-dimethylsilylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-dimethylsilylbutanoate?
The IUPAC name of ethyl 4-dimethylsilylbutanoate (CID 154502277) is ethyl 4-dimethylsilylbutanoate.
What is the SMILES notation for ethyl 4-dimethylsilylbutanoate?
The canonical SMILES for ethyl 4-dimethylsilylbutanoate is CCOC(=O)CCC[SiH](C)C.
What is the InChIKey of ethyl 4-dimethylsilylbutanoate?
The InChIKey is AKSGIFZZBBVHOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2Si/c1-4-10-8(9)6-5-7-11(2)3/h11H,4-7H2,1-3H3.
What are the key properties of ethyl 4-dimethylsilylbutanoate?
ethyl 4-dimethylsilylbutanoate has a molecular weight of 174.32 g/mol, XLogP of 1.82, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-dimethylsilylbutanoate is sourced from PubChem (CID 154502277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).