C14H20O5 — CID 15450240
ethyl (1R,4R,8S)-8-butoxy-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-6-carboxylate (PubChem CID 15450240) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is ethyl (1R,4R,8S)-8-butoxy-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-6-carboxylate.
| Compound Name | ethyl (1R,4R,8S)-8-butoxy-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-6-carboxylate |
|---|---|
| PubChem CID | 15450240 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | ethyl (1R,4R,8S)-8-butoxy-3-oxo-2-oxabicyclo[2.2.2]oct-5-ene-6-carboxylate |
| SMILES | CCCCO[C@H]1C[C@H]2OC(=O)[C@@H]1C=C2C(=O)OCC |
| InChI | InChI=1S/C14H20O5/c1-3-5-6-18-11-8-12-10(13(15)17-4-2)7-9(11)14(16)19-12/h7,9,11-12H,3-6,8H2,1-2H3/t9-,11+,12-/m1/s1 |
| InChIKey | PZCACDSFHWZWAM-ADEWGFFLSA-N |
| XLogP | 1.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|