C13H13NO6 — CID 10826505
propyl (1S,2S,6R,7S)-3,5,9-trioxo-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate (PubChem CID 10826505) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is propyl (1S,2S,6R,7S)-3,5,9-trioxo-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate.
| Compound Name | propyl (1S,2S,6R,7S)-3,5,9-trioxo-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate |
|---|---|
| PubChem CID | 10826505 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | propyl (1S,2S,6R,7S)-3,5,9-trioxo-8-oxa-4-azatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate |
| SMILES | CCCOC(=O)C1=C[C@@H]2C(=O)O[C@H]1[C@@H]1C(=O)NC(=O)[C@@H]12 |
| InChI | InChI=1S/C13H13NO6/c1-2-3-19-12(17)6-4-5-7-8(9(6)20-13(5)18)11(16)14-10(7)15/h4-5,7-9H,2-3H2,1H3,(H,14,15,16)/t5-,7+,8+,9+/m0/s1 |
| InChIKey | XUZRHNDUZNNVKJ-KDBVAPGDSA-N |
| XLogP | -0.69 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|