C31H50O6 — CID 154502988
(E,3R,5S)-7-[2-[1-(2,2-dimethylbutanoyloxy)decyl]-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoic acid (PubChem CID 154502988) has the molecular formula C31H50O6 and a molecular weight of 518.74 g/mol. Its IUPAC name is (E,3R,5S)-7-[2-[1-(2,2-dimethylbutanoyloxy)decyl]-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoic acid.
| Compound Name | (E,3R,5S)-7-[2-[1-(2,2-dimethylbutanoyloxy)decyl]-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoic acid |
|---|---|
| PubChem CID | 154502988 |
| Molecular Formula | C31H50O6 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | (E,3R,5S)-7-[2-[1-(2,2-dimethylbutanoyloxy)decyl]-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoic acid |
| SMILES | CCCCCCCCCC(OC(=O)C(C)(C)CC)c1cc(C)cc(C)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C31H50O6/c1-7-9-10-11-12-13-14-15-28(37-30(36)31(5,6)8-2)27-19-22(3)18-23(4)26(27)17-16-24(32)20-25(33)21-29(34)35/h16-19,24-25,28,32-33H,7-15,20-21H2,1-6H3,(H,34,35)/b17-16+/t24-,25-,28?/m1/s1 |
| InChIKey | PCYSRDSFNFXYKE-FVZWBEFESA-N |
| XLogP | 7.06 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|