C32H52O6 — CID 57101076
methyl (3R,5S)-7-[2-[1-(2,2-dimethylbutanoyloxy)decyl]-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoate (PubChem CID 57101076) has the molecular formula C32H52O6 and a molecular weight of 532.76 g/mol. Its IUPAC name is methyl (3R,5S)-7-[2-[1-(2,2-dimethylbutanoyloxy)decyl]-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoate.
| Compound Name | methyl (3R,5S)-7-[2-[1-(2,2-dimethylbutanoyloxy)decyl]-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoate |
|---|---|
| PubChem CID | 57101076 |
| Molecular Formula | C32H52O6 |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | methyl (3R,5S)-7-[2-[1-(2,2-dimethylbutanoyloxy)decyl]-4,6-dimethylphenyl]-3,5-dihydroxyhept-6-enoate |
| SMILES | CCCCCCCCCC(OC(=O)C(C)(C)CC)c1cc(C)cc(C)c1C=C[C@@H](O)C[C@@H](O)CC(=O)OC |
| InChI | InChI=1S/C32H52O6/c1-8-10-11-12-13-14-15-16-29(38-31(36)32(5,6)9-2)28-20-23(3)19-24(4)27(28)18-17-25(33)21-26(34)22-30(35)37-7/h17-20,25-26,29,33-34H,8-16,21-22H2,1-7H3/t25-,26-,29?/m1/s1 |
| InChIKey | MTPWIMYIFOYVRJ-CRMLLVLTSA-N |
| XLogP | 7.15 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|